C32H36O9 — CID 157265302
(Z)-4-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-(3,4,5-trimethoxyphenyl)but-2-en-1-one (PubChem CID 157265302) has the molecular formula C32H36O9 and a molecular weight of 564.63 g/mol. Its IUPAC name is (Z)-4-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-(3,4,5-trimethoxyphenyl)but-2-en-1-one.
| Compound Name | (Z)-4-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-(3,4,5-trimethoxyphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 157265302 |
| Molecular Formula | C32H36O9 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | (Z)-4-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-(3,4,5-trimethoxyphenyl)but-2-en-1-one |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OC)c2C/C=C\C(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H36O9/c1-34-25-15-14-21(13-12-20-16-26(35-2)31(40-7)27(17-20)36-3)23(30(25)39-6)10-9-11-24(33)22-18-28(37-4)32(41-8)29(19-22)38-5/h9,11-19H,10H2,1-8H3/b11-9-,13-12- |
| InChIKey | JERMKPNUHFZCMZ-KBMMCUQCSA-N |
| XLogP | 5.91 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|