C28H28O6 — CID 158934432
(Z)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-phenylbut-2-en-1-one (PubChem CID 158934432) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is (Z)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-phenylbut-2-en-1-one.
| Compound Name | (Z)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 158934432 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (Z)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-1-phenylbut-2-en-1-one |
| SMILES | COc1cc(C/C=C\C(=O)c2ccccc2)c(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C28H28O6/c1-31-25-18-21(11-8-12-23(29)20-9-6-5-7-10-20)22(17-24(25)30)14-13-19-15-26(32-2)28(34-4)27(16-19)33-3/h5-10,12-18,30H,11H2,1-4H3/b12-8-,14-13- |
| InChIKey | RFKBBLSKCQBHPB-PYASBWALSA-N |
| XLogP | 5.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|