C18H21NO4 — CID 123340958
[5-[2-(2-amino-4-methoxyphenyl)ethenyl]-2-(hydroxymethyl)-3-methoxyphenyl]methanol (PubChem CID 123340958) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [5-[2-(2-amino-4-methoxyphenyl)ethenyl]-2-(hydroxymethyl)-3-methoxyphenyl]methanol.
| Compound Name | [5-[2-(2-amino-4-methoxyphenyl)ethenyl]-2-(hydroxymethyl)-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 123340958 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [5-[2-(2-amino-4-methoxyphenyl)ethenyl]-2-(hydroxymethyl)-3-methoxyphenyl]methanol |
| SMILES | COc1ccc(C=Cc2cc(CO)c(CO)c(OC)c2)c(N)c1 |
| InChI | InChI=1S/C18H21NO4/c1-22-15-6-5-13(17(19)9-15)4-3-12-7-14(10-20)16(11-21)18(8-12)23-2/h3-9,20-21H,10-11,19H2,1-2H3 |
| InChIKey | ZPSLMKGYEFSHFI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|