C24H31O8P — CID 118421929
[5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] cyclohexyl hydrogen phosphate (PubChem CID 118421929) has the molecular formula C24H31O8P and a molecular weight of 478.48 g/mol. Its IUPAC name is [5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] cyclohexyl hydrogen phosphate.
| Compound Name | [5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] cyclohexyl hydrogen phosphate |
|---|---|
| PubChem CID | 118421929 |
| Molecular Formula | C24H31O8P |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] cyclohexyl hydrogen phosphate |
| SMILES | COc1ccc(/C=C\c2cc(CO)c(CO)c(OC)c2)cc1OP(=O)(O)OC1CCCCC1 |
| InChI | InChI=1S/C24H31O8P/c1-29-22-11-10-17(8-9-18-12-19(15-25)21(16-26)23(14-18)30-2)13-24(22)32-33(27,28)31-20-6-4-3-5-7-20/h8-14,20,25-26H,3-7,15-16H2,1-2H3,(H,27,28)/b9-8- |
| InChIKey | DFVWUQWNGBOKBQ-HJWRWDBZSA-N |
| XLogP | 4.69 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|