C18H21BrO8P+ — CID 89269632
[2-bromo-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-trihydroxyphosphanium (PubChem CID 89269632) has the molecular formula C18H21BrO8P+ and a molecular weight of 476.24 g/mol. Its IUPAC name is [2-bromo-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-trihydroxyphosphanium.
| Compound Name | [2-bromo-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 89269632 |
| Molecular Formula | C18H21BrO8P+ |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | [2-bromo-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-trihydroxyphosphanium |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(O[P+](O)(O)O)c2Br)cc(OC)c1OC |
| InChI | InChI=1S/C18H21BrO8P/c1-23-13-8-7-12(16(19)18(13)27-28(20,21)22)6-5-11-9-14(24-2)17(26-4)15(10-11)25-3/h5-10,20-22H,1-4H3/q+1/b6-5- |
| InChIKey | XZEMTYBFXFGQNB-WAYWQWQTSA-N |
| XLogP | 3.69 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|