C30H36BrNO9 — CID 134378247
2-[[3-(2-bromo-3,4,5-trimethoxyphenyl)-3-hydroxypropyl]amino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 134378247) has the molecular formula C30H36BrNO9 and a molecular weight of 634.52 g/mol. Its IUPAC name is 2-[[3-(2-bromo-3,4,5-trimethoxyphenyl)-3-hydroxypropyl]amino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | 2-[[3-(2-bromo-3,4,5-trimethoxyphenyl)-3-hydroxypropyl]amino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 134378247 |
| Molecular Formula | C30H36BrNO9 |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | 2-[[3-(2-bromo-3,4,5-trimethoxyphenyl)-3-hydroxypropyl]amino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(NCCC(O)c2cc(OC)c(OC)c(OC)c2Br)c1O |
| InChI | InChI=1S/C30H36BrNO9/c1-35-21-11-10-18(9-8-17-14-22(36-2)28(39-5)23(15-17)37-3)26(27(21)34)32-13-12-20(33)19-16-24(38-4)29(40-6)30(41-7)25(19)31/h8-11,14-16,20,32-34H,12-13H2,1-7H3/b9-8- |
| InChIKey | YQILBOZESKJLPC-HJWRWDBZSA-N |
| XLogP | 5.92 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|