C21H24N2O4 — CID 155537820
(1E,4E)-1-(3,4,5-trimethoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one (PubChem CID 155537820) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1E,4E)-1-(3,4,5-trimethoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3,4,5-trimethoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 155537820 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (1E,4E)-1-(3,4,5-trimethoxyphenyl)-5-(3,5,6-trimethylpyrazin-2-yl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2nc(C)c(C)nc2C)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O4/c1-13-14(2)23-18(15(3)22-13)10-9-17(24)8-7-16-11-19(25-4)21(27-6)20(12-16)26-5/h7-12H,1-6H3/b8-7+,10-9+ |
| InChIKey | NBGMGBHHJLPPOH-XBLVEGMJSA-N |
| XLogP | 3.72 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|