C22H26O3S — CID 67828238
3-(2,6-diethoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one (PubChem CID 67828238) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is 3-(2,6-diethoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,6-diethoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67828238 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-(2,6-diethoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CCCSc1ccc(C(=O)C=Cc2c(OCC)cccc2OCC)cc1 |
| InChI | InChI=1S/C22H26O3S/c1-4-16-26-18-12-10-17(11-13-18)20(23)15-14-19-21(24-5-2)8-7-9-22(19)25-6-3/h7-15H,4-6,16H2,1-3H3 |
| InChIKey | KAVICUKMQWMYPN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|