C19H20O2S — CID 54227661
3-(2,6-dimethoxyphenyl)-1-(4-ethylphenyl)prop-2-ene-1-thione (PubChem CID 54227661) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)-1-(4-ethylphenyl)prop-2-ene-1-thione.
| Compound Name | 3-(2,6-dimethoxyphenyl)-1-(4-ethylphenyl)prop-2-ene-1-thione |
|---|---|
| PubChem CID | 54227661 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)-1-(4-ethylphenyl)prop-2-ene-1-thione |
| SMILES | CCc1ccc(C(=S)C=Cc2c(OC)cccc2OC)cc1 |
| InChI | InChI=1S/C19H20O2S/c1-4-14-8-10-15(11-9-14)19(22)13-12-16-17(20-2)6-5-7-18(16)21-3/h5-13H,4H2,1-3H3 |
| InChIKey | QGZRGJGJVWBNSQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|