C23H28S — CID 54564764
1-(4-ethylphenyl)-3-(3,4,5-triethylphenyl)prop-2-ene-1-thione (PubChem CID 54564764) has the molecular formula C23H28S and a molecular weight of 336.54 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(3,4,5-triethylphenyl)prop-2-ene-1-thione.
| Compound Name | 1-(4-ethylphenyl)-3-(3,4,5-triethylphenyl)prop-2-ene-1-thione |
|---|---|
| PubChem CID | 54564764 |
| Molecular Formula | C23H28S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(3,4,5-triethylphenyl)prop-2-ene-1-thione |
| SMILES | CCc1ccc(C(=S)C=Cc2cc(CC)c(CC)c(CC)c2)cc1 |
| InChI | InChI=1S/C23H28S/c1-5-17-9-12-21(13-10-17)23(24)14-11-18-15-19(6-2)22(8-4)20(7-3)16-18/h9-16H,5-8H2,1-4H3 |
| InChIKey | ZTAJHKJTMCKYAE-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|