C32H42O8 — CID 18178750
[[4-[(E)-3-(3-tert-butyl-2,6-dimethoxyphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate (PubChem CID 18178750) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is [[4-[(E)-3-(3-tert-butyl-2,6-dimethoxyphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate.
| Compound Name | [[4-[(E)-3-(3-tert-butyl-2,6-dimethoxyphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18178750 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | [[4-[(E)-3-(3-tert-butyl-2,6-dimethoxyphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(C(C)(C)C)c(OC)c1/C=C/C(=O)c1ccc(OC(OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H42O8/c1-30(2,3)23-17-19-25(36-10)22(26(23)37-11)16-18-24(33)20-12-14-21(15-13-20)38-29(39-27(34)31(4,5)6)40-28(35)32(7,8)9/h12-19,29H,1-11H3/b18-16+ |
| InChIKey | ULSOEBKKJOMUPL-FBMGVBCBSA-N |
| XLogP | 6.74 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|