C29H36O8 — CID 54227631
[[4-[3-(2,6-dimethoxy-3-methylphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate (PubChem CID 54227631) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is [[4-[3-(2,6-dimethoxy-3-methylphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate.
| Compound Name | [[4-[3-(2,6-dimethoxy-3-methylphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54227631 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [[4-[3-(2,6-dimethoxy-3-methylphenyl)prop-2-enoyl]phenoxy]-(2,2-dimethylpropanoyloxy)methyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(C)c(OC)c1C=CC(=O)c1ccc(OC(OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H36O8/c1-18-10-17-23(33-8)21(24(18)34-9)15-16-22(30)19-11-13-20(14-12-19)35-27(36-25(31)28(2,3)4)37-26(32)29(5,6)7/h10-17,27H,1-9H3 |
| InChIKey | QGZGGBZRXKEZDS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|