C25H33NO3 — CID 54513919
1-[4-(methylamino)phenyl]-3-[3-methyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one (PubChem CID 54513919) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 1-[4-(methylamino)phenyl]-3-[3-methyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-(methylamino)phenyl]-3-[3-methyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54513919 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 1-[4-(methylamino)phenyl]-3-[3-methyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
| SMILES | CNc1ccc(C(=O)C=Cc2c(OC(C)(C)C)ccc(C)c2OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H33NO3/c1-17-9-16-22(28-24(2,3)4)20(23(17)29-25(5,6)7)14-15-21(27)18-10-12-19(26-8)13-11-18/h9-16,26H,1-8H3 |
| InChIKey | YLBKGGFOGVDJAB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|