C32H44O5 — CID 18178196
[4-[(E)-3-[3-tert-butyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 18178196) has the molecular formula C32H44O5 and a molecular weight of 508.70 g/mol. Its IUPAC name is [4-[(E)-3-[3-tert-butyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-3-[3-tert-butyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18178196 |
| Molecular Formula | C32H44O5 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | [4-[(E)-3-[3-tert-butyl-2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)Oc1ccc(C(C)(C)C)c(OC(C)(C)C)c1/C=C/C(=O)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H44O5/c1-29(2,3)24-18-20-26(36-31(7,8)9)23(27(24)37-32(10,11)12)17-19-25(33)21-13-15-22(16-14-21)35-28(34)30(4,5)6/h13-20H,1-12H3/b19-17+ |
| InChIKey | ZPXOSSWQBYFGNH-HTXNQAPBSA-N |
| XLogP | 8.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|