C22H25BrO3 — CID 7967106
(E)-3-(3-bromo-5-ethoxy-4-methoxyphenyl)-1-(4-tert-butylphenyl)prop-2-en-1-one (PubChem CID 7967106) has the molecular formula C22H25BrO3 and a molecular weight of 417.34 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-ethoxy-4-methoxyphenyl)-1-(4-tert-butylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-bromo-5-ethoxy-4-methoxyphenyl)-1-(4-tert-butylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7967106 |
| Molecular Formula | C22H25BrO3 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (E)-3-(3-bromo-5-ethoxy-4-methoxyphenyl)-1-(4-tert-butylphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(C(C)(C)C)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C22H25BrO3/c1-6-26-20-14-15(13-18(23)21(20)25-5)7-12-19(24)16-8-10-17(11-9-16)22(2,3)4/h7-14H,6H2,1-5H3/b12-7+ |
| InChIKey | IJFQLXMLHBNQKL-KPKJPENVSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|