C17H20O6 — CID 141075886
(2-ethoxyphenyl) 4-formyl-5-prop-2-enoyloxypentanoate (PubChem CID 141075886) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (2-ethoxyphenyl) 4-formyl-5-prop-2-enoyloxypentanoate.
| Compound Name | (2-ethoxyphenyl) 4-formyl-5-prop-2-enoyloxypentanoate |
|---|---|
| PubChem CID | 141075886 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2-ethoxyphenyl) 4-formyl-5-prop-2-enoyloxypentanoate |
| SMILES | C=CC(=O)OCC(C=O)CCC(=O)Oc1ccccc1OCC |
| InChI | InChI=1S/C17H20O6/c1-3-16(19)22-12-13(11-18)9-10-17(20)23-15-8-6-5-7-14(15)21-4-2/h3,5-8,11,13H,1,4,9-10,12H2,2H3 |
| InChIKey | IFPFHGPUERIXQN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|