C27H30NO4P — CID 89033808
[4-[2-[4-[amino-(2-methylphenoxy)phosphanyl]oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] prop-2-enoate (PubChem CID 89033808) has the molecular formula C27H30NO4P and a molecular weight of 463.51 g/mol. Its IUPAC name is [4-[2-[4-[amino-(2-methylphenoxy)phosphanyl]oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] prop-2-enoate.
| Compound Name | [4-[2-[4-[amino-(2-methylphenoxy)phosphanyl]oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 89033808 |
| Molecular Formula | C27H30NO4P |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [4-[2-[4-[amino-(2-methylphenoxy)phosphanyl]oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(C)(C)c2ccc(OP(N)Oc3ccccc3C)c(C)c2)cc1C |
| InChI | InChI=1S/C27H30NO4P/c1-7-26(29)30-23-14-12-21(16-19(23)3)27(5,6)22-13-15-25(20(4)17-22)32-33(28)31-24-11-9-8-10-18(24)2/h7-17H,1,28H2,2-6H3 |
| InChIKey | VAYSASOMPDZLII-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|