C23H22N2O2 — CID 176753434
[4-[2-(4-isocyanooxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] cyanate (PubChem CID 176753434) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is [4-[2-(4-isocyanooxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] cyanate.
| Compound Name | [4-[2-(4-isocyanooxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] cyanate |
|---|---|
| PubChem CID | 176753434 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [4-[2-(4-isocyanooxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] cyanate |
| SMILES | [C-]#[N+]Oc1ccc(C(C)(C)c2ccc(OC#N)c(CC=C)c2)cc1CC=C |
| InChI | InChI=1S/C23H22N2O2/c1-6-8-17-14-19(10-12-21(17)26-16-24)23(3,4)20-11-13-22(27-25-5)18(15-20)9-7-2/h6-7,10-15H,1-2,8-9H2,3-4H3 |
| InChIKey | UGVYFBLEXUNMDB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|