C14H16N2O2 — CID 114954745
4-[[(4-methyl-3-pyridinyl)methylamino]methyl]benzene-1,3-diol (PubChem CID 114954745) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[[(4-methyl-3-pyridinyl)methylamino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(4-methyl-3-pyridinyl)methylamino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 114954745 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-[[(4-methyl-3-pyridinyl)methylamino]methyl]benzene-1,3-diol |
| SMILES | Cc1ccncc1CNCc1ccc(O)cc1O |
| InChI | InChI=1S/C14H16N2O2/c1-10-4-5-15-8-12(10)9-16-7-11-2-3-13(17)6-14(11)18/h2-6,8,16-18H,7,9H2,1H3 |
| InChIKey | ORKGEZNHYSYKGV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|