C12H12BrNO2S — CID 63378742
4-[[(4-bromothiophen-2-yl)methylamino]methyl]benzene-1,3-diol (PubChem CID 63378742) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is 4-[[(4-bromothiophen-2-yl)methylamino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(4-bromothiophen-2-yl)methylamino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 63378742 |
| Molecular Formula | C12H12BrNO2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 4-[[(4-bromothiophen-2-yl)methylamino]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNCc2cc(Br)cs2)c(O)c1 |
| InChI | InChI=1S/C12H12BrNO2S/c13-9-3-11(17-7-9)6-14-5-8-1-2-10(15)4-12(8)16/h1-4,7,14-16H,5-6H2 |
| InChIKey | YQKHMTHQEPQFBY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|