C15H14BrNO3 — CID 107700357
5-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-2-methylphenol (PubChem CID 107700357) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 5-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-2-methylphenol.
| Compound Name | 5-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-2-methylphenol |
|---|---|
| PubChem CID | 107700357 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]-2-methylphenol |
| SMILES | Cc1ccc(NCc2cc3c(cc2Br)OCO3)cc1O |
| InChI | InChI=1S/C15H14BrNO3/c1-9-2-3-11(5-13(9)18)17-7-10-4-14-15(6-12(10)16)20-8-19-14/h2-6,17-18H,7-8H2,1H3 |
| InChIKey | LEECXYSMHXHXSY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |