About tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate
tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate (PubChem CID 102404976) has the molecular formula C17H22BrNO4
and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate |
| PubChem CID | 102404976 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate |
| SMILES | C=C(C)CN(Cc1cc2c(cc1Br)OCO2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22BrNO4/c1-11(2)8-19(16(20)23-17(3,4)5)9-12-6-14-15(7-13(12)18)22-10-21-14/h6-7H,1,8-10H2,2-5H3 |
| InChIKey | NRAHGDZZWZTPKJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate?
The IUPAC name of tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate (CID 102404976) is tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate.
What is the SMILES notation for tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate?
The canonical SMILES for tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate is C=C(C)CN(Cc1cc2c(cc1Br)OCO2)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate?
The InChIKey is NRAHGDZZWZTPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrNO4/c1-11(2)8-19(16(20)23-17(3,4)5)9-12-6-14-15(7-13(12)18)22-10-21-14/h6-7H,1,8-10H2,2-5H3.
What are the key properties of tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate?
tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate has a molecular weight of 384.27 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate is sourced from PubChem (CID 102404976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).