C17H22BrNO4 — CID 102404976
tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate (PubChem CID 102404976) has the molecular formula C17H22BrNO4 and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate.
| Compound Name | tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate |
|---|---|
| PubChem CID | 102404976 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-methylprop-2-enyl)carbamate |
| SMILES | C=C(C)CN(Cc1cc2c(cc1Br)OCO2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22BrNO4/c1-11(2)8-19(16(20)23-17(3,4)5)9-12-6-14-15(7-13(12)18)22-10-21-14/h6-7H,1,8-10H2,2-5H3 |
| InChIKey | NRAHGDZZWZTPKJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|