C12H15BrFNO3 — CID 167724582
tert-butyl N-[(5-bromo-3-fluoro-2-hydroxyphenyl)methyl]carbamate (PubChem CID 167724582) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-3-fluoro-2-hydroxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5-bromo-3-fluoro-2-hydroxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 167724582 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | tert-butyl N-[(5-bromo-3-fluoro-2-hydroxyphenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(Br)cc(F)c1O |
| InChI | InChI=1S/C12H15BrFNO3/c1-12(2,3)18-11(17)15-6-7-4-8(13)5-9(14)10(7)16/h4-5,16H,6H2,1-3H3,(H,15,17) |
| InChIKey | WWDWHOHNBMZGGC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|