About 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine
1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine (PubChem CID 43234592) has the molecular formula C14H18Cl3N
and a molecular weight of 306.66 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine |
| PubChem CID | 43234592 |
| Molecular Formula | C14H18Cl3N |
| Molecular Weight | 306.66 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine |
| SMILES | Clc1ccc(Cl)c(CNCC2CCCCC2)c1Cl |
| InChI | InChI=1S/C14H18Cl3N/c15-12-6-7-13(16)14(17)11(12)9-18-8-10-4-2-1-3-5-10/h6-7,10,18H,1-5,8-9H2 |
| InChIKey | FNDGHBSORSHSIV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine?
The IUPAC name of 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine (CID 43234592) is 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine.
What is the SMILES notation for 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine?
The canonical SMILES for 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine is Clc1ccc(Cl)c(CNCC2CCCCC2)c1Cl.
What is the InChIKey of 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine?
The InChIKey is FNDGHBSORSHSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl3N/c15-12-6-7-13(16)14(17)11(12)9-18-8-10-4-2-1-3-5-10/h6-7,10,18H,1-5,8-9H2.
What are the key properties of 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine?
1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine has a molecular weight of 306.66 g/mol, XLogP of 5.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-[(2,3,6-trichlorophenyl)methyl]methanamine is sourced from PubChem (CID 43234592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).