C16H21Cl3N2 — CID 66525054
1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3,6-trichlorophenyl)methyl]methanamine (PubChem CID 66525054) has the molecular formula C16H21Cl3N2 and a molecular weight of 347.72 g/mol. Its IUPAC name is 1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3,6-trichlorophenyl)methyl]methanamine.
| Compound Name | 1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3,6-trichlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 66525054 |
| Molecular Formula | C16H21Cl3N2 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3,6-trichlorophenyl)methyl]methanamine |
| SMILES | CN1C2CCC1CC(CNCc1c(Cl)ccc(Cl)c1Cl)C2 |
| InChI | InChI=1S/C16H21Cl3N2/c1-21-11-2-3-12(21)7-10(6-11)8-20-9-13-14(17)4-5-15(18)16(13)19/h4-5,10-12,20H,2-3,6-9H2,1H3 |
| InChIKey | OAWYOUDESWYGCW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|