C16H15Cl2N3S — CID 166187408
N-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine (PubChem CID 166187408) has the molecular formula C16H15Cl2N3S and a molecular weight of 352.29 g/mol. Its IUPAC name is N-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 166187408 |
| Molecular Formula | C16H15Cl2N3S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methyl]-1-thiophen-3-ylmethanamine |
| SMILES | Cc1nn(-c2ccccc2Cl)c(Cl)c1CNCc1ccsc1 |
| InChI | InChI=1S/C16H15Cl2N3S/c1-11-13(9-19-8-12-6-7-22-10-12)16(18)21(20-11)15-5-3-2-4-14(15)17/h2-7,10,19H,8-9H2,1H3 |
| InChIKey | VUHXYCMOMKQWKD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |