C14H17Cl2N3O — CID 111469404
2-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylamino]propan-1-ol (PubChem CID 111469404) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylamino]propan-1-ol.
| Compound Name | 2-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 111469404 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylamino]propan-1-ol |
| SMILES | Cc1nn(-c2ccccc2Cl)c(Cl)c1CNC(C)CO |
| InChI | InChI=1S/C14H17Cl2N3O/c1-9(8-20)17-7-11-10(2)18-19(14(11)16)13-6-4-3-5-12(13)15/h3-6,9,17,20H,7-8H2,1-2H3 |
| InChIKey | VQXDQSICQYSBMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |