C16H16ClNS2 — CID 63455663
N-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-thiophen-3-ylpropan-2-amine (PubChem CID 63455663) has the molecular formula C16H16ClNS2 and a molecular weight of 321.90 g/mol. Its IUPAC name is N-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-thiophen-3-ylpropan-2-amine.
| Compound Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 63455663 |
| Molecular Formula | C16H16ClNS2 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-thiophen-3-ylpropan-2-amine |
| SMILES | CC(Cc1ccsc1)NCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H16ClNS2/c1-11(8-12-6-7-19-10-12)18-9-15-16(17)13-4-2-3-5-14(13)20-15/h2-7,10-11,18H,8-9H2,1H3 |
| InChIKey | NIOQYWGZHWCIEM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |