C16H16Cl2O2 — CID 134968747
(3S,4S)-4-(3,4-dichlorophenyl)-4-phenylbutane-1,3-diol (PubChem CID 134968747) has the molecular formula C16H16Cl2O2 and a molecular weight of 311.21 g/mol. Its IUPAC name is (3S,4S)-4-(3,4-dichlorophenyl)-4-phenylbutane-1,3-diol.
| Compound Name | (3S,4S)-4-(3,4-dichlorophenyl)-4-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 134968747 |
| Molecular Formula | C16H16Cl2O2 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (3S,4S)-4-(3,4-dichlorophenyl)-4-phenylbutane-1,3-diol |
| SMILES | OCC[C@H](O)[C@@H](c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2O2/c17-13-7-6-12(10-14(13)18)16(15(20)8-9-19)11-4-2-1-3-5-11/h1-7,10,15-16,19-20H,8-9H2/t15-,16-/m0/s1 |
| InChIKey | LPKDTBQTAIQTFQ-HOTGVXAUSA-N |
| XLogP | 3.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |