C9H9Cl3O2S — CID 62084023
1-(3,4-dichlorophenyl)propane-1-sulfonyl chloride (PubChem CID 62084023) has the molecular formula C9H9Cl3O2S and a molecular weight of 287.60 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)propane-1-sulfonyl chloride.
| Compound Name | 1-(3,4-dichlorophenyl)propane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 62084023 |
| Molecular Formula | C9H9Cl3O2S |
| Molecular Weight | 287.60 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 1-(3,4-dichlorophenyl)propane-1-sulfonyl chloride |
| SMILES | CCC(c1ccc(Cl)c(Cl)c1)S(=O)(=O)Cl |
| InChI | InChI=1S/C9H9Cl3O2S/c1-2-9(15(12,13)14)6-3-4-7(10)8(11)5-6/h3-5,9H,2H2,1H3 |
| InChIKey | IZVBJNORFHEJET-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |