C16H16Cl3N — CID 105350097
N-methyl-1-[4-(2,4,6-trichlorophenyl)phenyl]propan-1-amine (PubChem CID 105350097) has the molecular formula C16H16Cl3N and a molecular weight of 328.67 g/mol. Its IUPAC name is N-methyl-1-[4-(2,4,6-trichlorophenyl)phenyl]propan-1-amine.
| Compound Name | N-methyl-1-[4-(2,4,6-trichlorophenyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 105350097 |
| Molecular Formula | C16H16Cl3N |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-methyl-1-[4-(2,4,6-trichlorophenyl)phenyl]propan-1-amine |
| SMILES | CCC(NC)c1ccc(-c2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl3N/c1-3-15(20-2)10-4-6-11(7-5-10)16-13(18)8-12(17)9-14(16)19/h4-9,15,20H,3H2,1-2H3 |
| InChIKey | NPBKCXHNJBVXKW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |