C13H21ClN2O — CID 116934028
1-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine (PubChem CID 116934028) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine.
| Compound Name | 1-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934028 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(3-chloro-4-ethoxyphenyl)-2-methylbutane-1,4-diamine |
| SMILES | CCOc1ccc(C(N)C(C)CCN)cc1Cl |
| InChI | InChI=1S/C13H21ClN2O/c1-3-17-12-5-4-10(8-11(12)14)13(16)9(2)6-7-15/h4-5,8-9,13H,3,6-7,15-16H2,1-2H3 |
| InChIKey | AXJOCZKGDFWEHY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |