C13H8Br2ClNO2S — CID 80538786
6-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 80538786) has the molecular formula C13H8Br2ClNO2S and a molecular weight of 437.54 g/mol. Its IUPAC name is 6-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 80538786 |
| Molecular Formula | C13H8Br2ClNO2S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 434.83 |
| IUPAC Name | 6-[chloro-(4,5-dibromothiophen-2-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(Cl)c3cc(Br)c(Br)s3)ccc21 |
| InChI | InChI=1S/C13H8Br2ClNO2S/c1-17-8-3-2-6(4-9(8)19-13(17)18)11(16)10-5-7(14)12(15)20-10/h2-5,11H,1H3 |
| InChIKey | APJBLWFGCIPHBY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|