C16H14ClNO2 — CID 62298792
6-[chloro-(3-methylphenyl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 62298792) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-[chloro-(3-methylphenyl)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[chloro-(3-methylphenyl)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62298792 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-[chloro-(3-methylphenyl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cc1cccc(C(Cl)c2ccc3c(c2)oc(=O)n3C)c1 |
| InChI | InChI=1S/C16H14ClNO2/c1-10-4-3-5-11(8-10)15(17)12-6-7-13-14(9-12)20-16(19)18(13)2/h3-9,15H,1-2H3 |
| InChIKey | QTHCOTLAHQKQHP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|