C15H10Br2ClNO2 — CID 107958846
6-[chloro-(2,4-dibromophenyl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 107958846) has the molecular formula C15H10Br2ClNO2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 6-[chloro-(2,4-dibromophenyl)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[chloro-(2,4-dibromophenyl)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 107958846 |
| Molecular Formula | C15H10Br2ClNO2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 428.88 |
| IUPAC Name | 6-[chloro-(2,4-dibromophenyl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(Cl)c3ccc(Br)cc3Br)ccc21 |
| InChI | InChI=1S/C15H10Br2ClNO2/c1-19-12-5-2-8(6-13(12)21-15(19)20)14(18)10-4-3-9(16)7-11(10)17/h2-7,14H,1H3 |
| InChIKey | ZDXNJQMOKFMZSG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|