About 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one
6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 107964753) has the molecular formula C13H8Cl3NO2S
and a molecular weight of 348.64 g/mol. Its IUPAC name is 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 107964753 |
| Molecular Formula | C13H8Cl3NO2S |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(Cl)c3cc(Cl)sc3Cl)ccc21 |
| InChI | InChI=1S/C13H8Cl3NO2S/c1-17-8-3-2-6(4-9(8)19-13(17)18)11(15)7-5-10(14)20-12(7)16/h2-5,11H,1H3 |
| InChIKey | PIXVMUWFXBQXLT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one (CID 107964753) is 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one is Cn1c(=O)oc2cc(C(Cl)c3cc(Cl)sc3Cl)ccc21.
What is the InChIKey of 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one?
The InChIKey is PIXVMUWFXBQXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl3NO2S/c1-17-8-3-2-6(4-9(8)19-13(17)18)11(15)7-5-10(14)20-12(7)16/h2-5,11H,1H3.
What are the key properties of 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one?
6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one has a molecular weight of 348.64 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 107964753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).