C14H10Cl3NOS — CID 107964509
5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 107964509) has the molecular formula C14H10Cl3NOS and a molecular weight of 346.67 g/mol. Its IUPAC name is 5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 107964509 |
| Molecular Formula | C14H10Cl3NOS |
| Molecular Weight | 346.67 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(Cl)c3cc(Cl)sc3Cl)ccc21 |
| InChI | InChI=1S/C14H10Cl3NOS/c1-18-10-3-2-7(4-8(10)5-12(18)19)13(16)9-6-11(15)20-14(9)17/h2-4,6,13H,5H2,1H3 |
| InChIKey | NPJPXILWJLDGEQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|