C16H13Cl2NO2 — CID 61087964
5-[(3,5-dichlorophenyl)-hydroxymethyl]-1-methyl-3H-indol-2-one (PubChem CID 61087964) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenyl)-hydroxymethyl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[(3,5-dichlorophenyl)-hydroxymethyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 61087964 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 5-[(3,5-dichlorophenyl)-hydroxymethyl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(O)c3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C16H13Cl2NO2/c1-19-14-3-2-9(4-10(14)7-15(19)20)16(21)11-5-12(17)8-13(18)6-11/h2-6,8,16,21H,7H2,1H3 |
| InChIKey | RIZJGGGZJXWKIX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |