C12H17N3O2 — CID 116942369
5-(1,2-diamino-3-hydroxypropyl)-1-methyl-3H-indol-2-one (PubChem CID 116942369) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-(1,2-diamino-3-hydroxypropyl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(1,2-diamino-3-hydroxypropyl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 116942369 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 5-(1,2-diamino-3-hydroxypropyl)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(N)C(N)CO)ccc21 |
| InChI | InChI=1S/C12H17N3O2/c1-15-10-3-2-7(12(14)9(13)6-16)4-8(10)5-11(15)17/h2-4,9,12,16H,5-6,13-14H2,1H3 |
| InChIKey | NCXRPDNZKJNJSZ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |