C13H19N3O — CID 116932622
5-(1,2-diamino-2-methylpropyl)-1-methyl-3H-indol-2-one (PubChem CID 116932622) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-(1,2-diamino-2-methylpropyl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(1,2-diamino-2-methylpropyl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 116932622 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 5-(1,2-diamino-2-methylpropyl)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(N)C(C)(C)N)ccc21 |
| InChI | InChI=1S/C13H19N3O/c1-13(2,15)12(14)8-4-5-10-9(6-8)7-11(17)16(10)3/h4-6,12H,7,14-15H2,1-3H3 |
| InChIKey | OYJWLISMKWXUSX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |