C11H10F3NO2 — CID 61087034
1-methyl-5-(2,2,2-trifluoro-1-hydroxyethyl)-3H-indol-2-one (PubChem CID 61087034) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 1-methyl-5-(2,2,2-trifluoro-1-hydroxyethyl)-3H-indol-2-one.
| Compound Name | 1-methyl-5-(2,2,2-trifluoro-1-hydroxyethyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 61087034 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-methyl-5-(2,2,2-trifluoro-1-hydroxyethyl)-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H10F3NO2/c1-15-8-3-2-6(10(17)11(12,13)14)4-7(8)5-9(15)16/h2-4,10,17H,5H2,1H3 |
| InChIKey | PYRFSIQNDSOIMM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |