C13H12F5NO2 — CID 63105598
1-methyl-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydroquinolin-2-one (PubChem CID 63105598) has the molecular formula C13H12F5NO2 and a molecular weight of 309.23 g/mol. Its IUPAC name is 1-methyl-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 63105598 |
| Molecular Formula | C13H12F5NO2 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-methyl-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C(O)C(F)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H12F5NO2/c1-19-9-4-2-8(6-7(9)3-5-10(19)20)11(21)12(14,15)13(16,17)18/h2,4,6,11,21H,3,5H2,1H3 |
| InChIKey | PQLXLXRZHYOCPK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|