C13H11ClF5NO — CID 63107266
6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 63107266) has the molecular formula C13H11ClF5NO and a molecular weight of 327.68 g/mol. Its IUPAC name is 6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 63107266 |
| Molecular Formula | C13H11ClF5NO |
| Molecular Weight | 327.68 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 6-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C(Cl)C(F)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H11ClF5NO/c1-20-9-4-2-8(6-7(9)3-5-10(20)21)11(14)12(15,16)13(17,18)19/h2,4,6,11H,3,5H2,1H3 |
| InChIKey | RZYSKWWWRRGUFJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|