C12H11F4NO2 — CID 79660633
1-methyl-5-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-3H-indol-2-one (PubChem CID 79660633) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is 1-methyl-5-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-3H-indol-2-one.
| Compound Name | 1-methyl-5-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 79660633 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-methyl-5-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(O)C(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C12H11F4NO2/c1-17-8-3-2-6(4-7(8)5-9(17)18)10(19)12(15,16)11(13)14/h2-4,10-11,19H,5H2,1H3 |
| InChIKey | CWDHSEDEALXFNH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|