C14H16F3NO3 — CID 103210146
5-[1-hydroxy-3-(2,2,2-trifluoroethoxy)propyl]-1-methyl-3H-indol-2-one (PubChem CID 103210146) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 5-[1-hydroxy-3-(2,2,2-trifluoroethoxy)propyl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[1-hydroxy-3-(2,2,2-trifluoroethoxy)propyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 103210146 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-[1-hydroxy-3-(2,2,2-trifluoroethoxy)propyl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(O)CCOCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H16F3NO3/c1-18-11-3-2-9(6-10(11)7-13(18)20)12(19)4-5-21-8-14(15,16)17/h2-3,6,12,19H,4-5,7-8H2,1H3 |
| InChIKey | KYQFCOQVBAWRTA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|