C16H12Cl3NO — CID 61084786
5-[chloro-(2,4-dichlorophenyl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 61084786) has the molecular formula C16H12Cl3NO and a molecular weight of 340.64 g/mol. Its IUPAC name is 5-[chloro-(2,4-dichlorophenyl)methyl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[chloro-(2,4-dichlorophenyl)methyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 61084786 |
| Molecular Formula | C16H12Cl3NO |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 5-[chloro-(2,4-dichlorophenyl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(Cl)c3ccc(Cl)cc3Cl)ccc21 |
| InChI | InChI=1S/C16H12Cl3NO/c1-20-14-5-2-9(6-10(14)7-15(20)21)16(19)12-4-3-11(17)8-13(12)18/h2-6,8,16H,7H2,1H3 |
| InChIKey | HZDAOWXGGSDPAU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|