C18H18ClNO — CID 61085613
5-[chloro-(3,5-dimethylphenyl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 61085613) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 5-[chloro-(3,5-dimethylphenyl)methyl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[chloro-(3,5-dimethylphenyl)methyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 61085613 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-[chloro-(3,5-dimethylphenyl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | Cc1cc(C)cc(C(Cl)c2ccc3c(c2)CC(=O)N3C)c1 |
| InChI | InChI=1S/C18H18ClNO/c1-11-6-12(2)8-15(7-11)18(19)13-4-5-16-14(9-13)10-17(21)20(16)3/h4-9,18H,10H2,1-3H3 |
| InChIKey | WQXFSYJEQPRIQH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|