About 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene
2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 20542326) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene.
Analyze 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The IUPAC name of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene (CID 20542326) is 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene.
What is the SMILES notation for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The canonical SMILES for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene is CC(C)c1cc2c(s1)CCC2.
What is the InChIKey of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The InChIKey is BFBYYUSWSWWJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S/c1-7(2)10-6-8-4-3-5-9(8)11-10/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene?
2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene has a molecular weight of 166.29 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophene is sourced from PubChem (CID 20542326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).