C15H16ClNS — CID 66459149
4-[1-chloro-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)propan-2-yl]pyridine (PubChem CID 66459149) has the molecular formula C15H16ClNS and a molecular weight of 277.82 g/mol. Its IUPAC name is 4-[1-chloro-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)propan-2-yl]pyridine.
| Compound Name | 4-[1-chloro-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)propan-2-yl]pyridine |
|---|---|
| PubChem CID | 66459149 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-[1-chloro-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)propan-2-yl]pyridine |
| SMILES | CC(c1ccncc1)C(Cl)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C15H16ClNS/c1-10(11-5-7-17-8-6-11)15(16)14-9-12-3-2-4-13(12)18-14/h5-10,15H,2-4H2,1H3 |
| InChIKey | GDAYHIAOLWRSSK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|