C17H19ClOS — CID 63432379
2-[chloro-(4-propan-2-yloxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 63432379) has the molecular formula C17H19ClOS and a molecular weight of 306.86 g/mol. Its IUPAC name is 2-[chloro-(4-propan-2-yloxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-[chloro-(4-propan-2-yloxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 63432379 |
| Molecular Formula | C17H19ClOS |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[chloro-(4-propan-2-yloxyphenyl)methyl]-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | CC(C)Oc1ccc(C(Cl)c2cc3c(s2)CCC3)cc1 |
| InChI | InChI=1S/C17H19ClOS/c1-11(2)19-14-8-6-12(7-9-14)17(18)16-10-13-4-3-5-15(13)20-16/h6-11,17H,3-5H2,1-2H3 |
| InChIKey | LKBSESWOFKPZGN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|